C23H28ClN3O5 — CID 142482754
1-[5-[[2-chloro-3-(2-methylpropoxy)phenyl]methoxy]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-2-carbonyl]pyrazole-3-carboxylic acid (PubChem CID 142482754) has the molecular formula C23H28ClN3O5 and a molecular weight of 461.95 g/mol. Its IUPAC name is 1-[5-[[2-chloro-3-(2-methylpropoxy)phenyl]methoxy]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-2-carbonyl]pyrazole-3-carboxylic acid.
| Compound Name | 1-[5-[[2-chloro-3-(2-methylpropoxy)phenyl]methoxy]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-2-carbonyl]pyrazole-3-carboxylic acid |
|---|---|
| PubChem CID | 142482754 |
| Molecular Formula | C23H28ClN3O5 |
| Molecular Weight | 461.95 g/mol |
| Exact Mass | 461.17 |
| IUPAC Name | 1-[5-[[2-chloro-3-(2-methylpropoxy)phenyl]methoxy]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-2-carbonyl]pyrazole-3-carboxylic acid |
| SMILES | CC(C)COc1cccc(COC2CC3CN(C(=O)n4ccc(C(=O)O)n4)CC3C2)c1Cl |
| InChI | InChI=1S/C23H28ClN3O5/c1-14(2)12-32-20-5-3-4-15(21(20)24)13-31-18-8-16-10-26(11-17(16)9-18)23(30)27-7-6-19(25-27)22(28)29/h3-7,14,16-18H,8-13H2,1-2H3,(H,28,29) |
| InChIKey | UVBPRLOYLIWOEE-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 93.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.95 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |