C22H27N3O3 — CID 161252985
1-[1-[(3aS,6aR)-5-[(3-methylphenyl)methoxy]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-2-carbonyl]-4-methylpyrazol-3-yl]ethanone (PubChem CID 161252985) has the molecular formula C22H27N3O3 and a molecular weight of 381.48 g/mol. Its IUPAC name is 1-[1-[(3aS,6aR)-5-[(3-methylphenyl)methoxy]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-2-carbonyl]-4-methylpyrazol-3-yl]ethanone.
| Compound Name | 1-[1-[(3aS,6aR)-5-[(3-methylphenyl)methoxy]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-2-carbonyl]-4-methylpyrazol-3-yl]ethanone |
|---|---|
| PubChem CID | 161252985 |
| Molecular Formula | C22H27N3O3 |
| Molecular Weight | 381.48 g/mol |
| Exact Mass | 381.21 |
| IUPAC Name | 1-[1-[(3aS,6aR)-5-[(3-methylphenyl)methoxy]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-2-carbonyl]-4-methylpyrazol-3-yl]ethanone |
| SMILES | CC(=O)c1nn(C(=O)N2C[C@H]3CC(OCc4cccc(C)c4)C[C@H]3C2)cc1C |
| InChI | InChI=1S/C22H27N3O3/c1-14-5-4-6-17(7-14)13-28-20-8-18-11-24(12-19(18)9-20)22(27)25-10-15(2)21(23-25)16(3)26/h4-7,10,18-20H,8-9,11-13H2,1-3H3/t18-,19+,20? |
| InChIKey | JETAQDHTKVYECK-YOFSQIOKSA-N |
| XLogP | 3.60 |
| TPSA | 64.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.48 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |