C22H21N5O4 — CID 135388672
3-[5-(3-pyrimidin-5-ylphenoxy)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-2-carbonyl]-1H-pyrazole-5-carboxylic acid (PubChem CID 135388672) has the molecular formula C22H21N5O4 and a molecular weight of 419.44 g/mol. Its IUPAC name is 3-[5-(3-pyrimidin-5-ylphenoxy)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-2-carbonyl]-1H-pyrazole-5-carboxylic acid.
| Compound Name | 3-[5-(3-pyrimidin-5-ylphenoxy)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-2-carbonyl]-1H-pyrazole-5-carboxylic acid |
|---|---|
| PubChem CID | 135388672 |
| Molecular Formula | C22H21N5O4 |
| Molecular Weight | 419.44 g/mol |
| Exact Mass | 419.16 |
| IUPAC Name | 3-[5-(3-pyrimidin-5-ylphenoxy)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-2-carbonyl]-1H-pyrazole-5-carboxylic acid |
| SMILES | O=C(O)c1cc(C(=O)N2CC3CC(Oc4cccc(-c5cncnc5)c4)CC3C2)n[nH]1 |
| InChI | InChI=1S/C22H21N5O4/c28-21(19-7-20(22(29)30)26-25-19)27-10-14-5-18(6-15(14)11-27)31-17-3-1-2-13(4-17)16-8-23-12-24-9-16/h1-4,7-9,12,14-15,18H,5-6,10-11H2,(H,25,26)(H,29,30) |
| InChIKey | ASECDBIUNGZFQV-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 121.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.44 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |