C20H24N4O2 — CID 110134846
[(3aR,6aS)-5-phenoxy-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl]-[2-(dimethylamino)pyrimidin-5-yl]methanone (PubChem CID 110134846) has the molecular formula C20H24N4O2 and a molecular weight of 352.44 g/mol. Its IUPAC name is [(3aR,6aS)-5-phenoxy-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl]-[2-(dimethylamino)pyrimidin-5-yl]methanone.
| Compound Name | [(3aR,6aS)-5-phenoxy-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl]-[2-(dimethylamino)pyrimidin-5-yl]methanone |
|---|---|
| PubChem CID | 110134846 |
| Molecular Formula | C20H24N4O2 |
| Molecular Weight | 352.44 g/mol |
| Exact Mass | 352.19 |
| IUPAC Name | [(3aR,6aS)-5-phenoxy-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl]-[2-(dimethylamino)pyrimidin-5-yl]methanone |
| SMILES | CN(C)c1ncc(C(=O)N2C[C@H]3CC(Oc4ccccc4)C[C@H]3C2)cn1 |
| InChI | InChI=1S/C20H24N4O2/c1-23(2)20-21-10-16(11-22-20)19(25)24-12-14-8-18(9-15(14)13-24)26-17-6-4-3-5-7-17/h3-7,10-11,14-15,18H,8-9,12-13H2,1-2H3/t14-,15+,18? |
| InChIKey | YXBLPMXRNWIBHQ-MVVMVCHASA-N |
| XLogP | 2.47 |
| TPSA | 58.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.44 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |