C19H23N3O2 — CID 118739929
[(3aR,6aS)-5-phenoxy-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl]-(1-ethylpyrazol-4-yl)methanone (PubChem CID 118739929) has the molecular formula C19H23N3O2 and a molecular weight of 325.41 g/mol. Its IUPAC name is [(3aR,6aS)-5-phenoxy-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl]-(1-ethylpyrazol-4-yl)methanone.
| Compound Name | [(3aR,6aS)-5-phenoxy-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl]-(1-ethylpyrazol-4-yl)methanone |
|---|---|
| PubChem CID | 118739929 |
| Molecular Formula | C19H23N3O2 |
| Molecular Weight | 325.41 g/mol |
| Exact Mass | 325.18 |
| IUPAC Name | [(3aR,6aS)-5-phenoxy-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl]-(1-ethylpyrazol-4-yl)methanone |
| SMILES | CCn1cc(C(=O)N2C[C@H]3CC(Oc4ccccc4)C[C@H]3C2)cn1 |
| InChI | InChI=1S/C19H23N3O2/c1-2-22-13-16(10-20-22)19(23)21-11-14-8-18(9-15(14)12-21)24-17-6-4-3-5-7-17/h3-7,10,13-15,18H,2,8-9,11-12H2,1H3/t14-,15+,18? |
| InChIKey | IXNLCBQBAWUHBN-MVVMVCHASA-N |
| XLogP | 2.83 |
| TPSA | 47.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.41 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |