C18H24N4O — CID 71913212
[3-(benzylamino)piperidin-1-yl]-(1-ethylpyrazol-4-yl)methanone (PubChem CID 71913212) has the molecular formula C18H24N4O and a molecular weight of 312.42 g/mol. Its IUPAC name is [3-(benzylamino)piperidin-1-yl]-(1-ethylpyrazol-4-yl)methanone.
| Compound Name | [3-(benzylamino)piperidin-1-yl]-(1-ethylpyrazol-4-yl)methanone |
|---|---|
| PubChem CID | 71913212 |
| Molecular Formula | C18H24N4O |
| Molecular Weight | 312.42 g/mol |
| Exact Mass | 312.20 |
| IUPAC Name | [3-(benzylamino)piperidin-1-yl]-(1-ethylpyrazol-4-yl)methanone |
| SMILES | CCn1cc(C(=O)N2CCCC(NCc3ccccc3)C2)cn1 |
| InChI | InChI=1S/C18H24N4O/c1-2-22-13-16(12-20-22)18(23)21-10-6-9-17(14-21)19-11-15-7-4-3-5-8-15/h3-5,7-8,12-13,17,19H,2,6,9-11,14H2,1H3 |
| InChIKey | JFDRWFLMFOLVKN-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.42 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |