C17H23ClN4O — CID 119489971
(1-benzylpyrazol-4-yl)-[3-(methylamino)piperidin-1-yl]methanone;hydrochloride (PubChem CID 119489971) has the molecular formula C17H23ClN4O and a molecular weight of 334.85 g/mol. Its IUPAC name is (1-benzylpyrazol-4-yl)-[3-(methylamino)piperidin-1-yl]methanone;hydrochloride.
| Compound Name | (1-benzylpyrazol-4-yl)-[3-(methylamino)piperidin-1-yl]methanone;hydrochloride |
|---|---|
| PubChem CID | 119489971 |
| Molecular Formula | C17H23ClN4O |
| Molecular Weight | 334.85 g/mol |
| Exact Mass | 334.16 |
| IUPAC Name | (1-benzylpyrazol-4-yl)-[3-(methylamino)piperidin-1-yl]methanone;hydrochloride |
| SMILES | CNC1CCCN(C(=O)c2cnn(Cc3ccccc3)c2)C1.Cl |
| InChI | InChI=1S/C17H22N4O.ClH/c1-18-16-8-5-9-20(13-16)17(22)15-10-19-21(12-15)11-14-6-3-2-4-7-14;/h2-4,6-7,10,12,16,18H,5,8-9,11,13H2,1H3;1H |
| InChIKey | AGGOKAAMHOUHOF-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.85 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |