C13H23ClN4O — CID 119396309
(1-ethylpyrazol-4-yl)-[3-(methylaminomethyl)piperidin-1-yl]methanone;hydrochloride (PubChem CID 119396309) has the molecular formula C13H23ClN4O and a molecular weight of 286.81 g/mol. Its IUPAC name is (1-ethylpyrazol-4-yl)-[3-(methylaminomethyl)piperidin-1-yl]methanone;hydrochloride.
| Compound Name | (1-ethylpyrazol-4-yl)-[3-(methylaminomethyl)piperidin-1-yl]methanone;hydrochloride |
|---|---|
| PubChem CID | 119396309 |
| Molecular Formula | C13H23ClN4O |
| Molecular Weight | 286.81 g/mol |
| Exact Mass | 286.16 |
| IUPAC Name | (1-ethylpyrazol-4-yl)-[3-(methylaminomethyl)piperidin-1-yl]methanone;hydrochloride |
| SMILES | CCn1cc(C(=O)N2CCCC(CNC)C2)cn1.Cl |
| InChI | InChI=1S/C13H22N4O.ClH/c1-3-17-10-12(8-15-17)13(18)16-6-4-5-11(9-16)7-14-2;/h8,10-11,14H,3-7,9H2,1-2H3;1H |
| InChIKey | CJRNYNOKFUEGPN-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.81 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |