C17H21ClN4O — CID 124684827
[1-(3-chlorophenyl)pyrazol-4-yl]-[(3R)-3-(methylaminomethyl)piperidin-1-yl]methanone (PubChem CID 124684827) has the molecular formula C17H21ClN4O and a molecular weight of 332.83 g/mol. Its IUPAC name is [1-(3-chlorophenyl)pyrazol-4-yl]-[(3R)-3-(methylaminomethyl)piperidin-1-yl]methanone.
| Compound Name | [1-(3-chlorophenyl)pyrazol-4-yl]-[(3R)-3-(methylaminomethyl)piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 124684827 |
| Molecular Formula | C17H21ClN4O |
| Molecular Weight | 332.83 g/mol |
| Exact Mass | 332.14 |
| IUPAC Name | [1-(3-chlorophenyl)pyrazol-4-yl]-[(3R)-3-(methylaminomethyl)piperidin-1-yl]methanone |
| SMILES | CNC[C@H]1CCCN(C(=O)c2cnn(-c3cccc(Cl)c3)c2)C1 |
| InChI | InChI=1S/C17H21ClN4O/c1-19-9-13-4-3-7-21(11-13)17(23)14-10-20-22(12-14)16-6-2-5-15(18)8-16/h2,5-6,8,10,12-13,19H,3-4,7,9,11H2,1H3/t13-/m1/s1 |
| InChIKey | XYQXMXQTAXUIJS-CYBMUJFWSA-N |
| XLogP | 2.60 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.83 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |