C18H24ClN5O — CID 119395236
[1-(3-chlorophenyl)-5-ethyltriazol-4-yl]-[3-(methylaminomethyl)piperidin-1-yl]methanone (PubChem CID 119395236) has the molecular formula C18H24ClN5O and a molecular weight of 361.88 g/mol. Its IUPAC name is [1-(3-chlorophenyl)-5-ethyltriazol-4-yl]-[3-(methylaminomethyl)piperidin-1-yl]methanone.
| Compound Name | [1-(3-chlorophenyl)-5-ethyltriazol-4-yl]-[3-(methylaminomethyl)piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 119395236 |
| Molecular Formula | C18H24ClN5O |
| Molecular Weight | 361.88 g/mol |
| Exact Mass | 361.17 |
| IUPAC Name | [1-(3-chlorophenyl)-5-ethyltriazol-4-yl]-[3-(methylaminomethyl)piperidin-1-yl]methanone |
| SMILES | CCc1c(C(=O)N2CCCC(CNC)C2)nnn1-c1cccc(Cl)c1 |
| InChI | InChI=1S/C18H24ClN5O/c1-3-16-17(18(25)23-9-5-6-13(12-23)11-20-2)21-22-24(16)15-8-4-7-14(19)10-15/h4,7-8,10,13,20H,3,5-6,9,11-12H2,1-2H3 |
| InChIKey | RJIUSPKMLWYPOI-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 63.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.88 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |