C18H22ClN5O2 — CID 119481502
N-(2-aminoethyl)-1-[1-(3-chlorophenyl)pyrazole-4-carbonyl]piperidine-3-carboxamide (PubChem CID 119481502) has the molecular formula C18H22ClN5O2 and a molecular weight of 375.86 g/mol. Its IUPAC name is N-(2-aminoethyl)-1-[1-(3-chlorophenyl)pyrazole-4-carbonyl]piperidine-3-carboxamide.
| Compound Name | N-(2-aminoethyl)-1-[1-(3-chlorophenyl)pyrazole-4-carbonyl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 119481502 |
| Molecular Formula | C18H22ClN5O2 |
| Molecular Weight | 375.86 g/mol |
| Exact Mass | 375.15 |
| IUPAC Name | N-(2-aminoethyl)-1-[1-(3-chlorophenyl)pyrazole-4-carbonyl]piperidine-3-carboxamide |
| SMILES | NCCNC(=O)C1CCCN(C(=O)c2cnn(-c3cccc(Cl)c3)c2)C1 |
| InChI | InChI=1S/C18H22ClN5O2/c19-15-4-1-5-16(9-15)24-12-14(10-22-24)18(26)23-8-2-3-13(11-23)17(25)21-7-6-20/h1,4-5,9-10,12-13H,2-3,6-8,11,20H2,(H,21,25) |
| InChIKey | DGAXXMBVQHFZCF-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 93.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.86 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |