C15H18Cl2N4O — CID 119579544
[1-(3-chlorophenyl)pyrazol-4-yl]-(3-methylpiperazin-1-yl)methanone;hydrochloride (PubChem CID 119579544) has the molecular formula C15H18Cl2N4O and a molecular weight of 341.24 g/mol. Its IUPAC name is [1-(3-chlorophenyl)pyrazol-4-yl]-(3-methylpiperazin-1-yl)methanone;hydrochloride.
| Compound Name | [1-(3-chlorophenyl)pyrazol-4-yl]-(3-methylpiperazin-1-yl)methanone;hydrochloride |
|---|---|
| PubChem CID | 119579544 |
| Molecular Formula | C15H18Cl2N4O |
| Molecular Weight | 341.24 g/mol |
| Exact Mass | 340.09 |
| IUPAC Name | [1-(3-chlorophenyl)pyrazol-4-yl]-(3-methylpiperazin-1-yl)methanone;hydrochloride |
| SMILES | CC1CN(C(=O)c2cnn(-c3cccc(Cl)c3)c2)CCN1.Cl |
| InChI | InChI=1S/C15H17ClN4O.ClH/c1-11-9-19(6-5-17-11)15(21)12-8-18-20(10-12)14-4-2-3-13(16)7-14;/h2-4,7-8,10-11,17H,5-6,9H2,1H3;1H |
| InChIKey | SGTBSEHASXCEGK-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.24 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |