C20H18Cl2N4O3S — CID 55883003
[1-(3-chlorophenyl)pyrazol-4-yl]-[4-(3-chlorophenyl)sulfonylpiperazin-1-yl]methanone (PubChem CID 55883003) has the molecular formula C20H18Cl2N4O3S and a molecular weight of 465.36 g/mol. Its IUPAC name is [1-(3-chlorophenyl)pyrazol-4-yl]-[4-(3-chlorophenyl)sulfonylpiperazin-1-yl]methanone.
| Compound Name | [1-(3-chlorophenyl)pyrazol-4-yl]-[4-(3-chlorophenyl)sulfonylpiperazin-1-yl]methanone |
|---|---|
| PubChem CID | 55883003 |
| Molecular Formula | C20H18Cl2N4O3S |
| Molecular Weight | 465.36 g/mol |
| Exact Mass | 464.05 |
| IUPAC Name | [1-(3-chlorophenyl)pyrazol-4-yl]-[4-(3-chlorophenyl)sulfonylpiperazin-1-yl]methanone |
| SMILES | O=C(c1cnn(-c2cccc(Cl)c2)c1)N1CCN(S(=O)(=O)c2cccc(Cl)c2)CC1 |
| InChI | InChI=1S/C20H18Cl2N4O3S/c21-16-3-1-5-18(11-16)26-14-15(13-23-26)20(27)24-7-9-25(10-8-24)30(28,29)19-6-2-4-17(22)12-19/h1-6,11-14H,7-10H2 |
| InChIKey | IQOKNASBUBRTHX-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 75.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.36 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |