C17H15Cl3N2O3S — CID 27562409
[4-(3-chlorophenyl)sulfonylpiperazin-1-yl]-(2,3-dichlorophenyl)methanone (PubChem CID 27562409) has the molecular formula C17H15Cl3N2O3S and a molecular weight of 433.74 g/mol. Its IUPAC name is [4-(3-chlorophenyl)sulfonylpiperazin-1-yl]-(2,3-dichlorophenyl)methanone.
| Compound Name | [4-(3-chlorophenyl)sulfonylpiperazin-1-yl]-(2,3-dichlorophenyl)methanone |
|---|---|
| PubChem CID | 27562409 |
| Molecular Formula | C17H15Cl3N2O3S |
| Molecular Weight | 433.74 g/mol |
| Exact Mass | 431.99 |
| IUPAC Name | [4-(3-chlorophenyl)sulfonylpiperazin-1-yl]-(2,3-dichlorophenyl)methanone |
| SMILES | O=C(c1cccc(Cl)c1Cl)N1CCN(S(=O)(=O)c2cccc(Cl)c2)CC1 |
| InChI | InChI=1S/C17H15Cl3N2O3S/c18-12-3-1-4-13(11-12)26(24,25)22-9-7-21(8-10-22)17(23)14-5-2-6-15(19)16(14)20/h1-6,11H,7-10H2 |
| InChIKey | WTVKYRKQJYWSSV-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.74 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |