C21H24Cl2N2O3S — CID 24765755
[4-(4-tert-butylphenyl)sulfonylpiperazin-1-yl]-(2,3-dichlorophenyl)methanone (PubChem CID 24765755) has the molecular formula C21H24Cl2N2O3S and a molecular weight of 455.41 g/mol. Its IUPAC name is [4-(4-tert-butylphenyl)sulfonylpiperazin-1-yl]-(2,3-dichlorophenyl)methanone.
| Compound Name | [4-(4-tert-butylphenyl)sulfonylpiperazin-1-yl]-(2,3-dichlorophenyl)methanone |
|---|---|
| PubChem CID | 24765755 |
| Molecular Formula | C21H24Cl2N2O3S |
| Molecular Weight | 455.41 g/mol |
| Exact Mass | 454.09 |
| IUPAC Name | [4-(4-tert-butylphenyl)sulfonylpiperazin-1-yl]-(2,3-dichlorophenyl)methanone |
| SMILES | CC(C)(C)c1ccc(S(=O)(=O)N2CCN(C(=O)c3cccc(Cl)c3Cl)CC2)cc1 |
| InChI | InChI=1S/C21H24Cl2N2O3S/c1-21(2,3)15-7-9-16(10-8-15)29(27,28)25-13-11-24(12-14-25)20(26)17-5-4-6-18(22)19(17)23/h4-10H,11-14H2,1-3H3 |
| InChIKey | BHGAWUCMPHHIBZ-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.41 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |