C17H16BrClN2O4S — CID 27163262
(5-bromo-2-hydroxyphenyl)-[4-(3-chlorophenyl)sulfonylpiperazin-1-yl]methanone (PubChem CID 27163262) has the molecular formula C17H16BrClN2O4S and a molecular weight of 459.75 g/mol. Its IUPAC name is (5-bromo-2-hydroxyphenyl)-[4-(3-chlorophenyl)sulfonylpiperazin-1-yl]methanone.
| Compound Name | (5-bromo-2-hydroxyphenyl)-[4-(3-chlorophenyl)sulfonylpiperazin-1-yl]methanone |
|---|---|
| PubChem CID | 27163262 |
| Molecular Formula | C17H16BrClN2O4S |
| Molecular Weight | 459.75 g/mol |
| Exact Mass | 457.97 |
| IUPAC Name | (5-bromo-2-hydroxyphenyl)-[4-(3-chlorophenyl)sulfonylpiperazin-1-yl]methanone |
| SMILES | O=C(c1cc(Br)ccc1O)N1CCN(S(=O)(=O)c2cccc(Cl)c2)CC1 |
| InChI | InChI=1S/C17H16BrClN2O4S/c18-12-4-5-16(22)15(10-12)17(23)20-6-8-21(9-7-20)26(24,25)14-3-1-2-13(19)11-14/h1-5,10-11,22H,6-9H2 |
| InChIKey | OKOQVZDUGUIZIY-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 77.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.75 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |