C19H19N3O — CID 97083074
[(3aR,7aR)-1,3,3a,4,7,7a-hexahydroisoindol-2-yl]-(2-phenylpyrimidin-5-yl)methanone (PubChem CID 97083074) has the molecular formula C19H19N3O and a molecular weight of 305.38 g/mol. Its IUPAC name is [(3aR,7aR)-1,3,3a,4,7,7a-hexahydroisoindol-2-yl]-(2-phenylpyrimidin-5-yl)methanone.
| Compound Name | [(3aR,7aR)-1,3,3a,4,7,7a-hexahydroisoindol-2-yl]-(2-phenylpyrimidin-5-yl)methanone |
|---|---|
| PubChem CID | 97083074 |
| Molecular Formula | C19H19N3O |
| Molecular Weight | 305.38 g/mol |
| Exact Mass | 305.15 |
| IUPAC Name | [(3aR,7aR)-1,3,3a,4,7,7a-hexahydroisoindol-2-yl]-(2-phenylpyrimidin-5-yl)methanone |
| SMILES | O=C(c1cnc(-c2ccccc2)nc1)N1C[C@@H]2CC=CC[C@H]2C1 |
| InChI | InChI=1S/C19H19N3O/c23-19(22-12-15-8-4-5-9-16(15)13-22)17-10-20-18(21-11-17)14-6-2-1-3-7-14/h1-7,10-11,15-16H,8-9,12-13H2/t15-,16-/m0/s1 |
| InChIKey | DZUUECLEGQREHN-HOTGVXAUSA-N |
| XLogP | 3.18 |
| TPSA | 46.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.38 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|