C21H20N4O — CID 122560459
[(3aR,7aS)-1,3,3a,4,7,7a-hexahydroisoindol-2-yl]-(4-imidazo[1,2-b]pyridazin-3-ylphenyl)methanone (PubChem CID 122560459) has the molecular formula C21H20N4O and a molecular weight of 344.42 g/mol. Its IUPAC name is [(3aR,7aS)-1,3,3a,4,7,7a-hexahydroisoindol-2-yl]-(4-imidazo[1,2-b]pyridazin-3-ylphenyl)methanone.
| Compound Name | [(3aR,7aS)-1,3,3a,4,7,7a-hexahydroisoindol-2-yl]-(4-imidazo[1,2-b]pyridazin-3-ylphenyl)methanone |
|---|---|
| PubChem CID | 122560459 |
| Molecular Formula | C21H20N4O |
| Molecular Weight | 344.42 g/mol |
| Exact Mass | 344.16 |
| IUPAC Name | [(3aR,7aS)-1,3,3a,4,7,7a-hexahydroisoindol-2-yl]-(4-imidazo[1,2-b]pyridazin-3-ylphenyl)methanone |
| SMILES | O=C(c1ccc(-c2cnc3cccnn23)cc1)N1C[C@H]2CC=CC[C@H]2C1 |
| InChI | InChI=1S/C21H20N4O/c26-21(24-13-17-4-1-2-5-18(17)14-24)16-9-7-15(8-10-16)19-12-22-20-6-3-11-23-25(19)20/h1-3,6-12,17-18H,4-5,13-14H2/t17-,18+ |
| InChIKey | JLHVFRRLOIYBFO-HDICACEKSA-N |
| XLogP | 3.43 |
| TPSA | 50.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.42 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|