C24H31N5O2 — CID 158958236
(5-hydroxy-6-methyl-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl)-[2-(4-phenylpiperazin-1-yl)pyrimidin-5-yl]methanone (PubChem CID 158958236) has the molecular formula C24H31N5O2 and a molecular weight of 421.55 g/mol. Its IUPAC name is (5-hydroxy-6-methyl-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl)-[2-(4-phenylpiperazin-1-yl)pyrimidin-5-yl]methanone.
| Compound Name | (5-hydroxy-6-methyl-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl)-[2-(4-phenylpiperazin-1-yl)pyrimidin-5-yl]methanone |
|---|---|
| PubChem CID | 158958236 |
| Molecular Formula | C24H31N5O2 |
| Molecular Weight | 421.55 g/mol |
| Exact Mass | 421.25 |
| IUPAC Name | (5-hydroxy-6-methyl-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl)-[2-(4-phenylpiperazin-1-yl)pyrimidin-5-yl]methanone |
| SMILES | CC1CC2CN(C(=O)c3cnc(N4CCN(c5ccccc5)CC4)nc3)CC2CC1O |
| InChI | InChI=1S/C24H31N5O2/c1-17-11-18-15-29(16-19(18)12-22(17)30)23(31)20-13-25-24(26-14-20)28-9-7-27(8-10-28)21-5-3-2-4-6-21/h2-6,13-14,17-19,22,30H,7-12,15-16H2,1H3 |
| InChIKey | MGWNBEWTJLOTON-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 72.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.55 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |