C24H31N5O3 — CID 135144580
(5,6-dihydroxy-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl)-[4-methyl-2-(4-phenylpiperazin-1-yl)pyrimidin-5-yl]methanone (PubChem CID 135144580) has the molecular formula C24H31N5O3 and a molecular weight of 437.54 g/mol. Its IUPAC name is (5,6-dihydroxy-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl)-[4-methyl-2-(4-phenylpiperazin-1-yl)pyrimidin-5-yl]methanone.
| Compound Name | (5,6-dihydroxy-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl)-[4-methyl-2-(4-phenylpiperazin-1-yl)pyrimidin-5-yl]methanone |
|---|---|
| PubChem CID | 135144580 |
| Molecular Formula | C24H31N5O3 |
| Molecular Weight | 437.54 g/mol |
| Exact Mass | 437.24 |
| IUPAC Name | (5,6-dihydroxy-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl)-[4-methyl-2-(4-phenylpiperazin-1-yl)pyrimidin-5-yl]methanone |
| SMILES | Cc1nc(N2CCN(c3ccccc3)CC2)ncc1C(=O)N1CC2CC(O)C(O)CC2C1 |
| InChI | InChI=1S/C24H31N5O3/c1-16-20(23(32)29-14-17-11-21(30)22(31)12-18(17)15-29)13-25-24(26-16)28-9-7-27(8-10-28)19-5-3-2-4-6-19/h2-6,13,17-18,21-22,30-31H,7-12,14-15H2,1H3 |
| InChIKey | KPCLNCJKOVKNGZ-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 93.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.54 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |