C16H25N5O — CID 110124580
[(5aS,9aR)-1,2,3,4,5,5a,6,8,9,9a-decahydropyrido[4,3-b]azepin-7-yl]-[2-(dimethylamino)pyrimidin-5-yl]methanone (PubChem CID 110124580) has the molecular formula C16H25N5O and a molecular weight of 303.41 g/mol. Its IUPAC name is [(5aS,9aR)-1,2,3,4,5,5a,6,8,9,9a-decahydropyrido[4,3-b]azepin-7-yl]-[2-(dimethylamino)pyrimidin-5-yl]methanone.
| Compound Name | [(5aS,9aR)-1,2,3,4,5,5a,6,8,9,9a-decahydropyrido[4,3-b]azepin-7-yl]-[2-(dimethylamino)pyrimidin-5-yl]methanone |
|---|---|
| PubChem CID | 110124580 |
| Molecular Formula | C16H25N5O |
| Molecular Weight | 303.41 g/mol |
| Exact Mass | 303.21 |
| IUPAC Name | [(5aS,9aR)-1,2,3,4,5,5a,6,8,9,9a-decahydropyrido[4,3-b]azepin-7-yl]-[2-(dimethylamino)pyrimidin-5-yl]methanone |
| SMILES | CN(C)c1ncc(C(=O)N2CC[C@H]3NCCCC[C@H]3C2)cn1 |
| InChI | InChI=1S/C16H25N5O/c1-20(2)16-18-9-13(10-19-16)15(22)21-8-6-14-12(11-21)5-3-4-7-17-14/h9-10,12,14,17H,3-8,11H2,1-2H3/t12-,14+/m0/s1 |
| InChIKey | NCMXLDOJJZBAKV-GXTWGEPZSA-N |
| XLogP | 1.15 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.41 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |