C16H20F2N2O — CID 146042425
1-[(4aR,8aS)-2,3,4,4a,5,7,8,8a-octahydro-1H-1,6-naphthyridin-6-yl]-2-(3,5-difluorophenyl)ethanone (PubChem CID 146042425) has the molecular formula C16H20F2N2O and a molecular weight of 294.34 g/mol. Its IUPAC name is 1-[(4aR,8aS)-2,3,4,4a,5,7,8,8a-octahydro-1H-1,6-naphthyridin-6-yl]-2-(3,5-difluorophenyl)ethanone.
| Compound Name | 1-[(4aR,8aS)-2,3,4,4a,5,7,8,8a-octahydro-1H-1,6-naphthyridin-6-yl]-2-(3,5-difluorophenyl)ethanone |
|---|---|
| PubChem CID | 146042425 |
| Molecular Formula | C16H20F2N2O |
| Molecular Weight | 294.34 g/mol |
| Exact Mass | 294.15 |
| IUPAC Name | 1-[(4aR,8aS)-2,3,4,4a,5,7,8,8a-octahydro-1H-1,6-naphthyridin-6-yl]-2-(3,5-difluorophenyl)ethanone |
| SMILES | O=C(Cc1cc(F)cc(F)c1)N1CC[C@@H]2NCCC[C@@H]2C1 |
| InChI | InChI=1S/C16H20F2N2O/c17-13-6-11(7-14(18)9-13)8-16(21)20-5-3-15-12(10-20)2-1-4-19-15/h6-7,9,12,15,19H,1-5,8,10H2/t12-,15+/m1/s1 |
| InChIKey | LZSQKAAXXGTZMY-DOMZBBRYSA-N |
| XLogP | 2.11 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.34 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |