C15H18F2N2O — CID 102680281
1-(1,2,3,4,4a,5,7,7a-octahydropyrrolo[3,4-b]pyridin-6-yl)-2-(3,4-difluorophenyl)ethanone (PubChem CID 102680281) has the molecular formula C15H18F2N2O and a molecular weight of 280.32 g/mol. Its IUPAC name is 1-(1,2,3,4,4a,5,7,7a-octahydropyrrolo[3,4-b]pyridin-6-yl)-2-(3,4-difluorophenyl)ethanone.
| Compound Name | 1-(1,2,3,4,4a,5,7,7a-octahydropyrrolo[3,4-b]pyridin-6-yl)-2-(3,4-difluorophenyl)ethanone |
|---|---|
| PubChem CID | 102680281 |
| Molecular Formula | C15H18F2N2O |
| Molecular Weight | 280.32 g/mol |
| Exact Mass | 280.14 |
| IUPAC Name | 1-(1,2,3,4,4a,5,7,7a-octahydropyrrolo[3,4-b]pyridin-6-yl)-2-(3,4-difluorophenyl)ethanone |
| SMILES | O=C(Cc1ccc(F)c(F)c1)N1CC2CCCNC2C1 |
| InChI | InChI=1S/C15H18F2N2O/c16-12-4-3-10(6-13(12)17)7-15(20)19-8-11-2-1-5-18-14(11)9-19/h3-4,6,11,14,18H,1-2,5,7-9H2 |
| InChIKey | ZDBJJNHITZVGJU-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.32 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |