C20H19Cl2F3N4O2 — CID 158792375
1-[1-[2-[(2,5-dichlorophenyl)methyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carbonyl]-4-(trifluoromethyl)pyrazol-3-yl]ethanone (PubChem CID 158792375) has the molecular formula C20H19Cl2F3N4O2 and a molecular weight of 475.30 g/mol. Its IUPAC name is 1-[1-[2-[(2,5-dichlorophenyl)methyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carbonyl]-4-(trifluoromethyl)pyrazol-3-yl]ethanone.
| Compound Name | 1-[1-[2-[(2,5-dichlorophenyl)methyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carbonyl]-4-(trifluoromethyl)pyrazol-3-yl]ethanone |
|---|---|
| PubChem CID | 158792375 |
| Molecular Formula | C20H19Cl2F3N4O2 |
| Molecular Weight | 475.30 g/mol |
| Exact Mass | 474.08 |
| IUPAC Name | 1-[1-[2-[(2,5-dichlorophenyl)methyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carbonyl]-4-(trifluoromethyl)pyrazol-3-yl]ethanone |
| SMILES | CC(=O)c1nn(C(=O)N2CC3CN(Cc4cc(Cl)ccc4Cl)CC3C2)cc1C(F)(F)F |
| InChI | InChI=1S/C20H19Cl2F3N4O2/c1-11(30)18-16(20(23,24)25)10-29(26-18)19(31)28-8-13-6-27(7-14(13)9-28)5-12-4-15(21)2-3-17(12)22/h2-4,10,13-14H,5-9H2,1H3 |
| InChIKey | XHGITQLMDZWWTG-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 58.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.30 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |