C26H28N4O4 — CID 139417593
1-[(3aR,6aS)-5-[methyl-[(3-phenoxyphenyl)methyl]amino]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-2-carbonyl]pyrazole-4-carboxylic acid (PubChem CID 139417593) has the molecular formula C26H28N4O4 and a molecular weight of 460.53 g/mol. Its IUPAC name is 1-[(3aR,6aS)-5-[methyl-[(3-phenoxyphenyl)methyl]amino]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-2-carbonyl]pyrazole-4-carboxylic acid.
| Compound Name | 1-[(3aR,6aS)-5-[methyl-[(3-phenoxyphenyl)methyl]amino]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-2-carbonyl]pyrazole-4-carboxylic acid |
|---|---|
| PubChem CID | 139417593 |
| Molecular Formula | C26H28N4O4 |
| Molecular Weight | 460.53 g/mol |
| Exact Mass | 460.21 |
| IUPAC Name | 1-[(3aR,6aS)-5-[methyl-[(3-phenoxyphenyl)methyl]amino]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-2-carbonyl]pyrazole-4-carboxylic acid |
| SMILES | CN(Cc1cccc(Oc2ccccc2)c1)C1C[C@@H]2CN(C(=O)n3cc(C(=O)O)cn3)C[C@@H]2C1 |
| InChI | InChI=1S/C26H28N4O4/c1-28(14-18-6-5-9-24(10-18)34-23-7-3-2-4-8-23)22-11-19-15-29(16-20(19)12-22)26(33)30-17-21(13-27-30)25(31)32/h2-10,13,17,19-20,22H,11-12,14-16H2,1H3,(H,31,32)/t19-,20+,22? |
| InChIKey | OAYDIFOZHYORJX-RLAPIPATSA-N |
| XLogP | 4.18 |
| TPSA | 87.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.53 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |