C20H23F2N5O3 — CID 145316192
[2-[(2,2-difluoro-1,3-benzodioxol-5-yl)methyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-[4-(dimethylamino)pyrazol-1-yl]methanone (PubChem CID 145316192) has the molecular formula C20H23F2N5O3 and a molecular weight of 419.43 g/mol. Its IUPAC name is [2-[(2,2-difluoro-1,3-benzodioxol-5-yl)methyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-[4-(dimethylamino)pyrazol-1-yl]methanone.
| Compound Name | [2-[(2,2-difluoro-1,3-benzodioxol-5-yl)methyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-[4-(dimethylamino)pyrazol-1-yl]methanone |
|---|---|
| PubChem CID | 145316192 |
| Molecular Formula | C20H23F2N5O3 |
| Molecular Weight | 419.43 g/mol |
| Exact Mass | 419.18 |
| IUPAC Name | [2-[(2,2-difluoro-1,3-benzodioxol-5-yl)methyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-[4-(dimethylamino)pyrazol-1-yl]methanone |
| SMILES | CN(C)c1cnn(C(=O)N2CC3CN(Cc4ccc5c(c4)OC(F)(F)O5)CC3C2)c1 |
| InChI | InChI=1S/C20H23F2N5O3/c1-24(2)16-6-23-27(12-16)19(28)26-10-14-8-25(9-15(14)11-26)7-13-3-4-17-18(5-13)30-20(21,22)29-17/h3-6,12,14-15H,7-11H2,1-2H3 |
| InChIKey | FIBBZKLHYMYACU-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 63.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.43 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |