C28H34ClN5O3 — CID 145316084
acetaldehyde;[2-[(3-chloro-5-phenylmethoxyphenyl)methyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-[4-(dimethylamino)pyrazol-1-yl]methanone (PubChem CID 145316084) has the molecular formula C28H34ClN5O3 and a molecular weight of 524.07 g/mol. Its IUPAC name is acetaldehyde;[2-[(3-chloro-5-phenylmethoxyphenyl)methyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-[4-(dimethylamino)pyrazol-1-yl]methanone.
| Compound Name | acetaldehyde;[2-[(3-chloro-5-phenylmethoxyphenyl)methyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-[4-(dimethylamino)pyrazol-1-yl]methanone |
|---|---|
| PubChem CID | 145316084 |
| Molecular Formula | C28H34ClN5O3 |
| Molecular Weight | 524.07 g/mol |
| Exact Mass | 523.24 |
| IUPAC Name | acetaldehyde;[2-[(3-chloro-5-phenylmethoxyphenyl)methyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-[4-(dimethylamino)pyrazol-1-yl]methanone |
| SMILES | CC=O.CN(C)c1cnn(C(=O)N2CC3CN(Cc4cc(Cl)cc(OCc5ccccc5)c4)CC3C2)c1 |
| InChI | InChI=1S/C26H30ClN5O2.C2H4O/c1-29(2)24-11-28-32(17-24)26(33)31-15-21-13-30(14-22(21)16-31)12-20-8-23(27)10-25(9-20)34-18-19-6-4-3-5-7-19;1-2-3/h3-11,17,21-22H,12-16,18H2,1-2H3;2H,1H3 |
| InChIKey | SWWGSESKKZMUFT-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 70.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.07 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|