C24H27F3N4O5 — CID 138563152
1-[2-[[4-(4-hydroxyoxan-4-yl)-2-(trifluoromethyl)phenyl]methyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carbonyl]pyrazole-3-carboxylic acid (PubChem CID 138563152) has the molecular formula C24H27F3N4O5 and a molecular weight of 508.50 g/mol. Its IUPAC name is 1-[2-[[4-(4-hydroxyoxan-4-yl)-2-(trifluoromethyl)phenyl]methyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carbonyl]pyrazole-3-carboxylic acid.
| Compound Name | 1-[2-[[4-(4-hydroxyoxan-4-yl)-2-(trifluoromethyl)phenyl]methyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carbonyl]pyrazole-3-carboxylic acid |
|---|---|
| PubChem CID | 138563152 |
| Molecular Formula | C24H27F3N4O5 |
| Molecular Weight | 508.50 g/mol |
| Exact Mass | 508.19 |
| IUPAC Name | 1-[2-[[4-(4-hydroxyoxan-4-yl)-2-(trifluoromethyl)phenyl]methyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carbonyl]pyrazole-3-carboxylic acid |
| SMILES | O=C(O)c1ccn(C(=O)N2CC3CN(Cc4ccc(C5(O)CCOCC5)cc4C(F)(F)F)CC3C2)n1 |
| InChI | InChI=1S/C24H27F3N4O5/c25-24(26,27)19-9-18(23(35)4-7-36-8-5-23)2-1-15(19)10-29-11-16-13-30(14-17(16)12-29)22(34)31-6-3-20(28-31)21(32)33/h1-3,6,9,16-17,35H,4-5,7-8,10-14H2,(H,32,33) |
| InChIKey | BOISSKDPMOGDRH-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 108.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.50 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |