C19H26F3N3O — CID 139417528
4-[4-(2,7-diazaspiro[4.4]nonan-2-ylmethyl)-3-(trifluoromethyl)phenyl]morpholine (PubChem CID 139417528) has the molecular formula C19H26F3N3O and a molecular weight of 369.43 g/mol. Its IUPAC name is 4-[4-(2,7-diazaspiro[4.4]nonan-2-ylmethyl)-3-(trifluoromethyl)phenyl]morpholine.
| Compound Name | 4-[4-(2,7-diazaspiro[4.4]nonan-2-ylmethyl)-3-(trifluoromethyl)phenyl]morpholine |
|---|---|
| PubChem CID | 139417528 |
| Molecular Formula | C19H26F3N3O |
| Molecular Weight | 369.43 g/mol |
| Exact Mass | 369.20 |
| IUPAC Name | 4-[4-(2,7-diazaspiro[4.4]nonan-2-ylmethyl)-3-(trifluoromethyl)phenyl]morpholine |
| SMILES | FC(F)(F)c1cc(N2CCOCC2)ccc1CN1CCC2(CCNC2)C1 |
| InChI | InChI=1S/C19H26F3N3O/c20-19(21,22)17-11-16(25-7-9-26-10-8-25)2-1-15(17)12-24-6-4-18(14-24)3-5-23-13-18/h1-2,11,23H,3-10,12-14H2 |
| InChIKey | OEIASWZCLRWVTI-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 27.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.43 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|