C24H36Cl2N4O3 — CID 145157492
tert-butyl 4-[[4-chloro-2-[3-(4-chlorobutanoylamino)pyrrolidin-1-yl]phenyl]methyl]piperazine-1-carboxylate (PubChem CID 145157492) has the molecular formula C24H36Cl2N4O3 and a molecular weight of 499.48 g/mol. Its IUPAC name is tert-butyl 4-[[4-chloro-2-[3-(4-chlorobutanoylamino)pyrrolidin-1-yl]phenyl]methyl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[[4-chloro-2-[3-(4-chlorobutanoylamino)pyrrolidin-1-yl]phenyl]methyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 145157492 |
| Molecular Formula | C24H36Cl2N4O3 |
| Molecular Weight | 499.48 g/mol |
| Exact Mass | 498.22 |
| IUPAC Name | tert-butyl 4-[[4-chloro-2-[3-(4-chlorobutanoylamino)pyrrolidin-1-yl]phenyl]methyl]piperazine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCN(Cc2ccc(Cl)cc2N2CCC(NC(=O)CCCCl)C2)CC1 |
| InChI | InChI=1S/C24H36Cl2N4O3/c1-24(2,3)33-23(32)29-13-11-28(12-14-29)16-18-6-7-19(26)15-21(18)30-10-8-20(17-30)27-22(31)5-4-9-25/h6-7,15,20H,4-5,8-14,16-17H2,1-3H3,(H,27,31) |
| InChIKey | VDRPVLMKCWWIJT-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 65.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.48 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|