C13H19ClIN3OS — CID 111801083
N'-[2-(2-chlorophenyl)-2-hydroxyethyl]thiomorpholine-4-carboximidamide;hydroiodide (PubChem CID 111801083) has the molecular formula C13H19ClIN3OS and a molecular weight of 427.74 g/mol. Its IUPAC name is N'-[2-(2-chlorophenyl)-2-hydroxyethyl]thiomorpholine-4-carboximidamide;hydroiodide.
| Compound Name | N'-[2-(2-chlorophenyl)-2-hydroxyethyl]thiomorpholine-4-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 111801083 |
| Molecular Formula | C13H19ClIN3OS |
| Molecular Weight | 427.74 g/mol |
| Exact Mass | 427.00 |
| IUPAC Name | N'-[2-(2-chlorophenyl)-2-hydroxyethyl]thiomorpholine-4-carboximidamide;hydroiodide |
| SMILES | I.N/C(=N\CC(O)c1ccccc1Cl)N1CCSCC1 |
| InChI | InChI=1S/C13H18ClN3OS.HI/c14-11-4-2-1-3-10(11)12(18)9-16-13(15)17-5-7-19-8-6-17;/h1-4,12,18H,5-9H2,(H2,15,16);1H |
| InChIKey | YDGDZCUXDIGHCP-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 61.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.74 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|