C24H40IN5O3 — CID 111812835
tert-butyl 4-[N'-[[4-(1-phenylethylamino)oxan-4-yl]methyl]carbamimidoyl]piperazine-1-carboxylate;hydroiodide (PubChem CID 111812835) has the molecular formula C24H40IN5O3 and a molecular weight of 573.52 g/mol. Its IUPAC name is tert-butyl 4-[N'-[[4-(1-phenylethylamino)oxan-4-yl]methyl]carbamimidoyl]piperazine-1-carboxylate;hydroiodide.
| Compound Name | tert-butyl 4-[N'-[[4-(1-phenylethylamino)oxan-4-yl]methyl]carbamimidoyl]piperazine-1-carboxylate;hydroiodide |
|---|---|
| PubChem CID | 111812835 |
| Molecular Formula | C24H40IN5O3 |
| Molecular Weight | 573.52 g/mol |
| Exact Mass | 573.22 |
| IUPAC Name | tert-butyl 4-[N'-[[4-(1-phenylethylamino)oxan-4-yl]methyl]carbamimidoyl]piperazine-1-carboxylate;hydroiodide |
| SMILES | CC(NC1(C/N=C(\N)N2CCN(C(=O)OC(C)(C)C)CC2)CCOCC1)c1ccccc1.I |
| InChI | InChI=1S/C24H39N5O3.HI/c1-19(20-8-6-5-7-9-20)27-24(10-16-31-17-11-24)18-26-21(25)28-12-14-29(15-13-28)22(30)32-23(2,3)4;/h5-9,19,27H,10-18H2,1-4H3,(H2,25,26);1H |
| InChIKey | XRGNXUKJEMRMKW-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.52 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|