C23H35N3O4 — CID 75454851
tert-butyl 3-[[4-(1-phenylethylamino)oxan-4-yl]methylcarbamoyl]azetidine-1-carboxylate (PubChem CID 75454851) has the molecular formula C23H35N3O4 and a molecular weight of 417.55 g/mol. Its IUPAC name is tert-butyl 3-[[4-(1-phenylethylamino)oxan-4-yl]methylcarbamoyl]azetidine-1-carboxylate.
| Compound Name | tert-butyl 3-[[4-(1-phenylethylamino)oxan-4-yl]methylcarbamoyl]azetidine-1-carboxylate |
|---|---|
| PubChem CID | 75454851 |
| Molecular Formula | C23H35N3O4 |
| Molecular Weight | 417.55 g/mol |
| Exact Mass | 417.26 |
| IUPAC Name | tert-butyl 3-[[4-(1-phenylethylamino)oxan-4-yl]methylcarbamoyl]azetidine-1-carboxylate |
| SMILES | CC(NC1(CNC(=O)C2CN(C(=O)OC(C)(C)C)C2)CCOCC1)c1ccccc1 |
| InChI | InChI=1S/C23H35N3O4/c1-17(18-8-6-5-7-9-18)25-23(10-12-29-13-11-23)16-24-20(27)19-14-26(15-19)21(28)30-22(2,3)4/h5-9,17,19,25H,10-16H2,1-4H3,(H,24,27) |
| InChIKey | QWCWFLHKYGPRTL-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.55 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |