C24H37N3O3 — CID 86947103
N-[3-oxo-3-[[4-(1-phenylethylamino)oxan-4-yl]methylamino]propyl]cyclohexanecarboxamide (PubChem CID 86947103) has the molecular formula C24H37N3O3 and a molecular weight of 415.58 g/mol. Its IUPAC name is N-[3-oxo-3-[[4-(1-phenylethylamino)oxan-4-yl]methylamino]propyl]cyclohexanecarboxamide.
| Compound Name | N-[3-oxo-3-[[4-(1-phenylethylamino)oxan-4-yl]methylamino]propyl]cyclohexanecarboxamide |
|---|---|
| PubChem CID | 86947103 |
| Molecular Formula | C24H37N3O3 |
| Molecular Weight | 415.58 g/mol |
| Exact Mass | 415.28 |
| IUPAC Name | N-[3-oxo-3-[[4-(1-phenylethylamino)oxan-4-yl]methylamino]propyl]cyclohexanecarboxamide |
| SMILES | CC(NC1(CNC(=O)CCNC(=O)C2CCCCC2)CCOCC1)c1ccccc1 |
| InChI | InChI=1S/C24H37N3O3/c1-19(20-8-4-2-5-9-20)27-24(13-16-30-17-14-24)18-26-22(28)12-15-25-23(29)21-10-6-3-7-11-21/h2,4-5,8-9,19,21,27H,3,6-7,10-18H2,1H3,(H,25,29)(H,26,28) |
| InChIKey | OTGWRRXDZAGVNX-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.58 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |