C12H24N4O — CID 110030013
1-cyclopropyl-1-methyl-2-(2-morpholin-4-ylpropyl)guanidine (PubChem CID 110030013) has the molecular formula C12H24N4O and a molecular weight of 240.35 g/mol. Its IUPAC name is 1-cyclopropyl-1-methyl-2-(2-morpholin-4-ylpropyl)guanidine.
| Compound Name | 1-cyclopropyl-1-methyl-2-(2-morpholin-4-ylpropyl)guanidine |
|---|---|
| PubChem CID | 110030013 |
| Molecular Formula | C12H24N4O |
| Molecular Weight | 240.35 g/mol |
| Exact Mass | 240.20 |
| IUPAC Name | 1-cyclopropyl-1-methyl-2-(2-morpholin-4-ylpropyl)guanidine |
| SMILES | CC(C/N=C(\N)N(C)C1CC1)N1CCOCC1 |
| InChI | InChI=1S/C12H24N4O/c1-10(16-5-7-17-8-6-16)9-14-12(13)15(2)11-3-4-11/h10-11H,3-9H2,1-2H3,(H2,13,14) |
| InChIKey | PLUXOUMFNWTKPB-UHFFFAOYSA-N |
| XLogP | 0.12 |
| TPSA | 54.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.35 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|