C13H27N3OS — CID 120661776
N'-(2-ethyl-2-methylsulfanylbutyl)-2-methylmorpholine-4-carboximidamide (PubChem CID 120661776) has the molecular formula C13H27N3OS and a molecular weight of 273.45 g/mol. Its IUPAC name is N'-(2-ethyl-2-methylsulfanylbutyl)-2-methylmorpholine-4-carboximidamide.
| Compound Name | N'-(2-ethyl-2-methylsulfanylbutyl)-2-methylmorpholine-4-carboximidamide |
|---|---|
| PubChem CID | 120661776 |
| Molecular Formula | C13H27N3OS |
| Molecular Weight | 273.45 g/mol |
| Exact Mass | 273.19 |
| IUPAC Name | N'-(2-ethyl-2-methylsulfanylbutyl)-2-methylmorpholine-4-carboximidamide |
| SMILES | CCC(CC)(C/N=C(\N)N1CCOC(C)C1)SC |
| InChI | InChI=1S/C13H27N3OS/c1-5-13(6-2,18-4)10-15-12(14)16-7-8-17-11(3)9-16/h11H,5-10H2,1-4H3,(H2,14,15) |
| InChIKey | BEJAKEOQZYMNFC-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 50.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.45 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|