C15H28N4O2S — CID 111097601
tert-butyl N-[2-[[amino(thiomorpholin-4-yl)methylidene]amino]ethyl]-N-cyclopropylcarbamate (PubChem CID 111097601) has the molecular formula C15H28N4O2S and a molecular weight of 328.48 g/mol. Its IUPAC name is tert-butyl N-[2-[[amino(thiomorpholin-4-yl)methylidene]amino]ethyl]-N-cyclopropylcarbamate.
| Compound Name | tert-butyl N-[2-[[amino(thiomorpholin-4-yl)methylidene]amino]ethyl]-N-cyclopropylcarbamate |
|---|---|
| PubChem CID | 111097601 |
| Molecular Formula | C15H28N4O2S |
| Molecular Weight | 328.48 g/mol |
| Exact Mass | 328.19 |
| IUPAC Name | tert-butyl N-[2-[[amino(thiomorpholin-4-yl)methylidene]amino]ethyl]-N-cyclopropylcarbamate |
| SMILES | CC(C)(C)OC(=O)N(CC/N=C(\N)N1CCSCC1)C1CC1 |
| InChI | InChI=1S/C15H28N4O2S/c1-15(2,3)21-14(20)19(12-4-5-12)7-6-17-13(16)18-8-10-22-11-9-18/h12H,4-11H2,1-3H3,(H2,16,17) |
| InChIKey | IVJQXKSGBPWVOM-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 71.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.48 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|