C10H20IN3OS — CID 111810423
N'-[(3-methyloxetan-3-yl)methyl]thiomorpholine-4-carboximidamide;hydroiodide (PubChem CID 111810423) has the molecular formula C10H20IN3OS and a molecular weight of 357.26 g/mol. Its IUPAC name is N'-[(3-methyloxetan-3-yl)methyl]thiomorpholine-4-carboximidamide;hydroiodide.
| Compound Name | N'-[(3-methyloxetan-3-yl)methyl]thiomorpholine-4-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 111810423 |
| Molecular Formula | C10H20IN3OS |
| Molecular Weight | 357.26 g/mol |
| Exact Mass | 357.04 |
| IUPAC Name | N'-[(3-methyloxetan-3-yl)methyl]thiomorpholine-4-carboximidamide;hydroiodide |
| SMILES | CC1(C/N=C(\N)N2CCSCC2)COC1.I |
| InChI | InChI=1S/C10H19N3OS.HI/c1-10(7-14-8-10)6-12-9(11)13-2-4-15-5-3-13;/h2-8H2,1H3,(H2,11,12);1H |
| InChIKey | RSOLAHHQYVPPKI-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 50.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.26 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|