C14H19FIN3S — CID 120606097
N'-[(1R,2S)-2-(4-fluorophenyl)cyclopropyl]thiomorpholine-4-carboximidamide;hydroiodide (PubChem CID 120606097) has the molecular formula C14H19FIN3S and a molecular weight of 407.30 g/mol. Its IUPAC name is N'-[(1R,2S)-2-(4-fluorophenyl)cyclopropyl]thiomorpholine-4-carboximidamide;hydroiodide.
| Compound Name | N'-[(1R,2S)-2-(4-fluorophenyl)cyclopropyl]thiomorpholine-4-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 120606097 |
| Molecular Formula | C14H19FIN3S |
| Molecular Weight | 407.30 g/mol |
| Exact Mass | 407.03 |
| IUPAC Name | N'-[(1R,2S)-2-(4-fluorophenyl)cyclopropyl]thiomorpholine-4-carboximidamide;hydroiodide |
| SMILES | I.N/C(=N\[C@@H]1C[C@H]1c1ccc(F)cc1)N1CCSCC1 |
| InChI | InChI=1S/C14H18FN3S.HI/c15-11-3-1-10(2-4-11)12-9-13(12)17-14(16)18-5-7-19-8-6-18;/h1-4,12-13H,5-9H2,(H2,16,17);1H/t12-,13+;/m0./s1 |
| InChIKey | UHQBLRGFNYLCQR-JHEYCYPBSA-N |
| XLogP | 2.66 |
| TPSA | 41.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.30 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|