C15H21BrIN3 — CID 111096242
N'-[2-(4-bromophenyl)cyclopropyl]piperidine-1-carboximidamide;hydroiodide (PubChem CID 111096242) has the molecular formula C15H21BrIN3 and a molecular weight of 450.16 g/mol. Its IUPAC name is N'-[2-(4-bromophenyl)cyclopropyl]piperidine-1-carboximidamide;hydroiodide.
| Compound Name | N'-[2-(4-bromophenyl)cyclopropyl]piperidine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 111096242 |
| Molecular Formula | C15H21BrIN3 |
| Molecular Weight | 450.16 g/mol |
| Exact Mass | 449.00 |
| IUPAC Name | N'-[2-(4-bromophenyl)cyclopropyl]piperidine-1-carboximidamide;hydroiodide |
| SMILES | I.N/C(=N\C1CC1c1ccc(Br)cc1)N1CCCCC1 |
| InChI | InChI=1S/C15H20BrN3.HI/c16-12-6-4-11(5-7-12)13-10-14(13)18-15(17)19-8-2-1-3-9-19;/h4-7,13-14H,1-3,8-10H2,(H2,17,18);1H |
| InChIKey | AGFJLLUMTMHWRN-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 41.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.16 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|