C15H19F2N3 — CID 111815372
N'-[2-(2,6-difluorophenyl)cyclopropyl]piperidine-1-carboximidamide (PubChem CID 111815372) has the molecular formula C15H19F2N3 and a molecular weight of 279.33 g/mol. Its IUPAC name is N'-[2-(2,6-difluorophenyl)cyclopropyl]piperidine-1-carboximidamide.
| Compound Name | N'-[2-(2,6-difluorophenyl)cyclopropyl]piperidine-1-carboximidamide |
|---|---|
| PubChem CID | 111815372 |
| Molecular Formula | C15H19F2N3 |
| Molecular Weight | 279.33 g/mol |
| Exact Mass | 279.15 |
| IUPAC Name | N'-[2-(2,6-difluorophenyl)cyclopropyl]piperidine-1-carboximidamide |
| SMILES | N/C(=N\C1CC1c1c(F)cccc1F)N1CCCCC1 |
| InChI | InChI=1S/C15H19F2N3/c16-11-5-4-6-12(17)14(11)10-9-13(10)19-15(18)20-7-2-1-3-8-20/h4-6,10,13H,1-3,7-9H2,(H2,18,19) |
| InChIKey | YENZNFVNERDNPM-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 41.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.33 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|