C19H27F2IN4O2 — CID 111815337
tert-butyl 4-[N'-[2-(2,6-difluorophenyl)cyclopropyl]carbamimidoyl]piperazine-1-carboxylate;hydroiodide (PubChem CID 111815337) has the molecular formula C19H27F2IN4O2 and a molecular weight of 508.35 g/mol. Its IUPAC name is tert-butyl 4-[N'-[2-(2,6-difluorophenyl)cyclopropyl]carbamimidoyl]piperazine-1-carboxylate;hydroiodide.
| Compound Name | tert-butyl 4-[N'-[2-(2,6-difluorophenyl)cyclopropyl]carbamimidoyl]piperazine-1-carboxylate;hydroiodide |
|---|---|
| PubChem CID | 111815337 |
| Molecular Formula | C19H27F2IN4O2 |
| Molecular Weight | 508.35 g/mol |
| Exact Mass | 508.11 |
| IUPAC Name | tert-butyl 4-[N'-[2-(2,6-difluorophenyl)cyclopropyl]carbamimidoyl]piperazine-1-carboxylate;hydroiodide |
| SMILES | CC(C)(C)OC(=O)N1CCN(/C(N)=N/C2CC2c2c(F)cccc2F)CC1.I |
| InChI | InChI=1S/C19H26F2N4O2.HI/c1-19(2,3)27-18(26)25-9-7-24(8-10-25)17(22)23-15-11-12(15)16-13(20)5-4-6-14(16)21;/h4-6,12,15H,7-11H2,1-3H3,(H2,22,23);1H |
| InChIKey | VJTIDLWMKGZHII-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 71.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.35 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|