C20H22F2N4 — CID 111101089
4-(4-fluorophenyl)-N'-[2-(2-fluorophenyl)cyclopropyl]piperazine-1-carboximidamide (PubChem CID 111101089) has the molecular formula C20H22F2N4 and a molecular weight of 356.42 g/mol. Its IUPAC name is 4-(4-fluorophenyl)-N'-[2-(2-fluorophenyl)cyclopropyl]piperazine-1-carboximidamide.
| Compound Name | 4-(4-fluorophenyl)-N'-[2-(2-fluorophenyl)cyclopropyl]piperazine-1-carboximidamide |
|---|---|
| PubChem CID | 111101089 |
| Molecular Formula | C20H22F2N4 |
| Molecular Weight | 356.42 g/mol |
| Exact Mass | 356.18 |
| IUPAC Name | 4-(4-fluorophenyl)-N'-[2-(2-fluorophenyl)cyclopropyl]piperazine-1-carboximidamide |
| SMILES | N/C(=N\C1CC1c1ccccc1F)N1CCN(c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C20H22F2N4/c21-14-5-7-15(8-6-14)25-9-11-26(12-10-25)20(23)24-19-13-17(19)16-3-1-2-4-18(16)22/h1-8,17,19H,9-13H2,(H2,23,24) |
| InChIKey | POGKIUULUVRAQH-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 44.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.42 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|