C15H19F2N3OS — CID 120671512
N'-[(1S,2R)-2-[2-(difluoromethoxy)phenyl]cyclopropyl]thiomorpholine-4-carboximidamide (PubChem CID 120671512) has the molecular formula C15H19F2N3OS and a molecular weight of 327.40 g/mol. Its IUPAC name is N'-[(1S,2R)-2-[2-(difluoromethoxy)phenyl]cyclopropyl]thiomorpholine-4-carboximidamide.
| Compound Name | N'-[(1S,2R)-2-[2-(difluoromethoxy)phenyl]cyclopropyl]thiomorpholine-4-carboximidamide |
|---|---|
| PubChem CID | 120671512 |
| Molecular Formula | C15H19F2N3OS |
| Molecular Weight | 327.40 g/mol |
| Exact Mass | 327.12 |
| IUPAC Name | N'-[(1S,2R)-2-[2-(difluoromethoxy)phenyl]cyclopropyl]thiomorpholine-4-carboximidamide |
| SMILES | N/C(=N\[C@H]1C[C@@H]1c1ccccc1OC(F)F)N1CCSCC1 |
| InChI | InChI=1S/C15H19F2N3OS/c16-14(17)21-13-4-2-1-3-10(13)11-9-12(11)19-15(18)20-5-7-22-8-6-20/h1-4,11-12,14H,5-9H2,(H2,18,19)/t11-,12+/m1/s1 |
| InChIKey | IXXYBXHHOPPTTG-NEPJUHHUSA-N |
| XLogP | 2.51 |
| TPSA | 50.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.40 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|