C20H22F2IN3O3 — CID 120671485
2-[(1S,2R)-2-[2-(difluoromethoxy)phenyl]cyclopropyl]-1-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)guanidine;hydroiodide (PubChem CID 120671485) has the molecular formula C20H22F2IN3O3 and a molecular weight of 517.31 g/mol. Its IUPAC name is 2-[(1S,2R)-2-[2-(difluoromethoxy)phenyl]cyclopropyl]-1-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)guanidine;hydroiodide.
| Compound Name | 2-[(1S,2R)-2-[2-(difluoromethoxy)phenyl]cyclopropyl]-1-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 120671485 |
| Molecular Formula | C20H22F2IN3O3 |
| Molecular Weight | 517.31 g/mol |
| Exact Mass | 517.07 |
| IUPAC Name | 2-[(1S,2R)-2-[2-(difluoromethoxy)phenyl]cyclopropyl]-1-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)guanidine;hydroiodide |
| SMILES | I.N/C(=N\[C@H]1C[C@@H]1c1ccccc1OC(F)F)Nc1ccc2c(c1)OCCCO2 |
| InChI | InChI=1S/C20H21F2N3O3.HI/c21-19(22)28-16-5-2-1-4-13(16)14-11-15(14)25-20(23)24-12-6-7-17-18(10-12)27-9-3-8-26-17;/h1-2,4-7,10,14-15,19H,3,8-9,11H2,(H3,23,24,25);1H/t14-,15+;/m1./s1 |
| InChIKey | YDLQIQODMJVBJI-LIOBNPLQSA-N |
| XLogP | 4.35 |
| TPSA | 78.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.31 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|