C22H28IN3O2 — CID 111818803
1-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)-2-[2-(4-propan-2-ylphenyl)cyclopropyl]guanidine;hydroiodide (PubChem CID 111818803) has the molecular formula C22H28IN3O2 and a molecular weight of 493.39 g/mol. Its IUPAC name is 1-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)-2-[2-(4-propan-2-ylphenyl)cyclopropyl]guanidine;hydroiodide.
| Compound Name | 1-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)-2-[2-(4-propan-2-ylphenyl)cyclopropyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111818803 |
| Molecular Formula | C22H28IN3O2 |
| Molecular Weight | 493.39 g/mol |
| Exact Mass | 493.12 |
| IUPAC Name | 1-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)-2-[2-(4-propan-2-ylphenyl)cyclopropyl]guanidine;hydroiodide |
| SMILES | CC(C)c1ccc(C2CC2/N=C(\N)Nc2ccc3c(c2)OCCCO3)cc1.I |
| InChI | InChI=1S/C22H27N3O2.HI/c1-14(2)15-4-6-16(7-5-15)18-13-19(18)25-22(23)24-17-8-9-20-21(12-17)27-11-3-10-26-20;/h4-9,12,14,18-19H,3,10-11,13H2,1-2H3,(H3,23,24,25);1H |
| InChIKey | NHMQPYKGRGQCGG-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 68.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.39 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|