C18H21FIN3 — CID 120606121
1-(3,4-dimethylphenyl)-2-[(1R,2S)-2-(4-fluorophenyl)cyclopropyl]guanidine;hydroiodide (PubChem CID 120606121) has the molecular formula C18H21FIN3 and a molecular weight of 425.29 g/mol. Its IUPAC name is 1-(3,4-dimethylphenyl)-2-[(1R,2S)-2-(4-fluorophenyl)cyclopropyl]guanidine;hydroiodide.
| Compound Name | 1-(3,4-dimethylphenyl)-2-[(1R,2S)-2-(4-fluorophenyl)cyclopropyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 120606121 |
| Molecular Formula | C18H21FIN3 |
| Molecular Weight | 425.29 g/mol |
| Exact Mass | 425.08 |
| IUPAC Name | 1-(3,4-dimethylphenyl)-2-[(1R,2S)-2-(4-fluorophenyl)cyclopropyl]guanidine;hydroiodide |
| SMILES | Cc1ccc(N/C(N)=N/[C@@H]2C[C@H]2c2ccc(F)cc2)cc1C.I |
| InChI | InChI=1S/C18H20FN3.HI/c1-11-3-8-15(9-12(11)2)21-18(20)22-17-10-16(17)13-4-6-14(19)7-5-13;/h3-9,16-17H,10H2,1-2H3,(H3,20,21,22);1H/t16-,17+;/m0./s1 |
| InChIKey | KGWUBWZMLGJSFJ-MCJVGQIASA-N |
| XLogP | 4.34 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.29 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|