C14H20FN3 — CID 120606076
1-tert-butyl-2-[(1R,2S)-2-(4-fluorophenyl)cyclopropyl]guanidine (PubChem CID 120606076) has the molecular formula C14H20FN3 and a molecular weight of 249.33 g/mol. Its IUPAC name is 1-tert-butyl-2-[(1R,2S)-2-(4-fluorophenyl)cyclopropyl]guanidine.
| Compound Name | 1-tert-butyl-2-[(1R,2S)-2-(4-fluorophenyl)cyclopropyl]guanidine |
|---|---|
| PubChem CID | 120606076 |
| Molecular Formula | C14H20FN3 |
| Molecular Weight | 249.33 g/mol |
| Exact Mass | 249.16 |
| IUPAC Name | 1-tert-butyl-2-[(1R,2S)-2-(4-fluorophenyl)cyclopropyl]guanidine |
| SMILES | CC(C)(C)N/C(N)=N/[C@@H]1C[C@H]1c1ccc(F)cc1 |
| InChI | InChI=1S/C14H20FN3/c1-14(2,3)18-13(16)17-12-8-11(12)9-4-6-10(15)7-5-9/h4-7,11-12H,8H2,1-3H3,(H3,16,17,18)/t11-,12+/m0/s1 |
| InChIKey | YCJWPJZGVQSICD-NWDGAFQWSA-N |
| XLogP | 2.38 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.33 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|