C17H17F2N3 — CID 111815308
2-[2-(2,6-difluorophenyl)cyclopropyl]-1-(3-methylphenyl)guanidine (PubChem CID 111815308) has the molecular formula C17H17F2N3 and a molecular weight of 301.34 g/mol. Its IUPAC name is 2-[2-(2,6-difluorophenyl)cyclopropyl]-1-(3-methylphenyl)guanidine.
| Compound Name | 2-[2-(2,6-difluorophenyl)cyclopropyl]-1-(3-methylphenyl)guanidine |
|---|---|
| PubChem CID | 111815308 |
| Molecular Formula | C17H17F2N3 |
| Molecular Weight | 301.34 g/mol |
| Exact Mass | 301.14 |
| IUPAC Name | 2-[2-(2,6-difluorophenyl)cyclopropyl]-1-(3-methylphenyl)guanidine |
| SMILES | Cc1cccc(N/C(N)=N/C2CC2c2c(F)cccc2F)c1 |
| InChI | InChI=1S/C17H17F2N3/c1-10-4-2-5-11(8-10)21-17(20)22-15-9-12(15)16-13(18)6-3-7-14(16)19/h2-8,12,15H,9H2,1H3,(H3,20,21,22) |
| InChIKey | AGTULUXTPLFAEB-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.34 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|