C20H23F2N3O2 — CID 111815388
1-(2,5-diethoxyphenyl)-2-[2-(2,6-difluorophenyl)cyclopropyl]guanidine (PubChem CID 111815388) has the molecular formula C20H23F2N3O2 and a molecular weight of 375.42 g/mol. Its IUPAC name is 1-(2,5-diethoxyphenyl)-2-[2-(2,6-difluorophenyl)cyclopropyl]guanidine.
| Compound Name | 1-(2,5-diethoxyphenyl)-2-[2-(2,6-difluorophenyl)cyclopropyl]guanidine |
|---|---|
| PubChem CID | 111815388 |
| Molecular Formula | C20H23F2N3O2 |
| Molecular Weight | 375.42 g/mol |
| Exact Mass | 375.18 |
| IUPAC Name | 1-(2,5-diethoxyphenyl)-2-[2-(2,6-difluorophenyl)cyclopropyl]guanidine |
| SMILES | CCOc1ccc(OCC)c(N/C(N)=N/C2CC2c2c(F)cccc2F)c1 |
| InChI | InChI=1S/C20H23F2N3O2/c1-3-26-12-8-9-18(27-4-2)17(10-12)25-20(23)24-16-11-13(16)19-14(21)6-5-7-15(19)22/h5-10,13,16H,3-4,11H2,1-2H3,(H3,23,24,25) |
| InChIKey | RNWXQYHODRAWIJ-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 68.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.42 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|